C12H20N4O6 — CID 136703965
(2S)-2-amino-5-[[5-oxo-4-[(2R,3R)-2,3,4-trihydroxybutyl]imidazol-2-ylidene]amino]pentanoic acid (PubChem CID 136703965) has the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2S)-2-amino-5-[[5-oxo-4-[(2R,3R)-2,3,4-trihydroxybutyl]imidazol-2-ylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[5-oxo-4-[(2R,3R)-2,3,4-trihydroxybutyl]imidazol-2-ylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 136703965 |
| Molecular Formula | C12H20N4O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2S)-2-amino-5-[[5-oxo-4-[(2R,3R)-2,3,4-trihydroxybutyl]imidazol-2-ylidene]amino]pentanoic acid |
| SMILES | N[C@@H](CCC/N=C1\N=C(C[C@@H](O)[C@H](O)CO)C(=O)N1)C(=O)O |
| InChI | InChI=1S/C12H20N4O6/c13-6(11(21)22)2-1-3-14-12-15-7(10(20)16-12)4-8(18)9(19)5-17/h6,8-9,17-19H,1-5,13H2,(H,21,22)(H,14,16,20)/t6-,8+,9+/m0/s1 |
| InChIKey | AZCGLRCREFXNCU-NBEYISGCSA-N |
| XLogP | -2.79 |
| TPSA | 177.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|