C20H21ClN4O2 — CID 91228054
4-[5-chloro-2-[[methyl(prop-2-enyl)amino]methyl]anilino]-7-methoxyquinazolin-6-ol (PubChem CID 91228054) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 4-[5-chloro-2-[[methyl(prop-2-enyl)amino]methyl]anilino]-7-methoxyquinazolin-6-ol.
| Compound Name | 4-[5-chloro-2-[[methyl(prop-2-enyl)amino]methyl]anilino]-7-methoxyquinazolin-6-ol |
|---|---|
| PubChem CID | 91228054 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[5-chloro-2-[[methyl(prop-2-enyl)amino]methyl]anilino]-7-methoxyquinazolin-6-ol |
| SMILES | C=CCN(C)Cc1ccc(Cl)cc1Nc1ncnc2cc(OC)c(O)cc12 |
| InChI | InChI=1S/C20H21ClN4O2/c1-4-7-25(2)11-13-5-6-14(21)8-16(13)24-20-15-9-18(26)19(27-3)10-17(15)22-12-23-20/h4-6,8-10,12,26H,1,7,11H2,2-3H3,(H,22,23,24) |
| InChIKey | SZPWJOSOWLRNAH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|