C22H27ClN4O2 — CID 151361258
4-[5-chloro-2-[(hexan-2-ylamino)methyl]anilino]-7-methoxyquinazolin-6-ol (PubChem CID 151361258) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 4-[5-chloro-2-[(hexan-2-ylamino)methyl]anilino]-7-methoxyquinazolin-6-ol.
| Compound Name | 4-[5-chloro-2-[(hexan-2-ylamino)methyl]anilino]-7-methoxyquinazolin-6-ol |
|---|---|
| PubChem CID | 151361258 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[5-chloro-2-[(hexan-2-ylamino)methyl]anilino]-7-methoxyquinazolin-6-ol |
| SMILES | CCCCC(C)NCc1ccc(Cl)cc1Nc1ncnc2cc(OC)c(O)cc12 |
| InChI | InChI=1S/C22H27ClN4O2/c1-4-5-6-14(2)24-12-15-7-8-16(23)9-18(15)27-22-17-10-20(28)21(29-3)11-19(17)25-13-26-22/h7-11,13-14,24,28H,4-6,12H2,1-3H3,(H,25,26,27) |
| InChIKey | OONFXBYKUKBCRU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |