C14H11Cl4NO8 — CID 91229053
4,5,6,7-tetrachloro-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 91229053) has the molecular formula C14H11Cl4NO8 and a molecular weight of 463.05 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91229053 |
| Molecular Formula | C14H11Cl4NO8 |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 460.92 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1[C@]1(O)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H11Cl4NO8/c15-5-3-4(6(16)8(18)7(5)17)12(24)19(11(3)23)14(26)10(22)9(21)2(1-20)27-13(14)25/h2,9-10,13,20-22,25-26H,1H2/t2-,9-,10+,13?,14-/m1/s1 |
| InChIKey | WNEUBISEIQKSLS-CQEZFPAPSA-N |
| XLogP | 0.02 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|