C8H7NO5 — CID 91230103
3-(2,5-dihydroxypyrrol-1-yl)oxolane-2,5-dione (PubChem CID 91230103) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)oxolane-2,5-dione.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 91230103 |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)oxolane-2,5-dione |
| SMILES | O=C1CC(n2c(O)ccc2O)C(=O)O1 |
| InChI | InChI=1S/C8H7NO5/c10-5-1-2-6(11)9(5)4-3-7(12)14-8(4)13/h1-2,4,10-11H,3H2 |
| InChIKey | UTJDLSPWWXHZSW-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|