C11H5N3OS — CID 91232568
4-(1,3-thiazol-4-yloxy)benzene-1,3-dicarbonitrile (PubChem CID 91232568) has the molecular formula C11H5N3OS and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-yloxy)benzene-1,3-dicarbonitrile.
| Compound Name | 4-(1,3-thiazol-4-yloxy)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 91232568 |
| Molecular Formula | C11H5N3OS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 4-(1,3-thiazol-4-yloxy)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2cscn2)c(C#N)c1 |
| InChI | InChI=1S/C11H5N3OS/c12-4-8-1-2-10(9(3-8)5-13)15-11-6-16-7-14-11/h1-3,6-7H |
| InChIKey | WKLZFGPNEAXDMZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |