C28H34F3N5O3 — CID 91234334
N-[2-[[(3R)-4-[1-(4-acetamido-3-methylphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 91234334) has the molecular formula C28H34F3N5O3 and a molecular weight of 545.61 g/mol. Its IUPAC name is N-[2-[[(3R)-4-[1-(4-acetamido-3-methylphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3R)-4-[1-(4-acetamido-3-methylphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91234334 |
| Molecular Formula | C28H34F3N5O3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | N-[2-[[(3R)-4-[1-(4-acetamido-3-methylphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC(=O)Nc1ccc(N2CCC(C3CNC[C@@H]3NC(=O)CNC(=O)c3cccc(C(F)(F)F)c3)CC2)cc1C |
| InChI | InChI=1S/C28H34F3N5O3/c1-17-12-22(6-7-24(17)34-18(2)37)36-10-8-19(9-11-36)23-14-32-15-25(23)35-26(38)16-33-27(39)20-4-3-5-21(13-20)28(29,30)31/h3-7,12-13,19,23,25,32H,8-11,14-16H2,1-2H3,(H,33,39)(H,34,37)(H,35,38)/t23?,25-/m0/s1 |
| InChIKey | JEPDPGCJSPJQJE-YNMFNDETSA-N |
| XLogP | 3.32 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|