About N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide
N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide (PubChem CID 91236908) has the molecular formula C20H18N2O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide |
| PubChem CID | 91236908 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide |
| SMILES | NC(=NO)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18N2O2/c21-19(22-24)20(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-13-18(23)14-12-17/h1-14,23-24H,(H2,21,22) |
| InChIKey | JARZZRNJYJMZBI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide?
The IUPAC name of N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide (CID 91236908) is N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide.
What is the SMILES notation for N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide?
The canonical SMILES for N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide is NC(=NO)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide?
The InChIKey is JARZZRNJYJMZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2/c21-19(22-24)20(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-13-18(23)14-12-17/h1-14,23-24H,(H2,21,22).
What are the key properties of N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide?
N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide has a molecular weight of 318.38 g/mol, XLogP of 3.47, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-2-(4-hydroxyphenyl)-2,2-diphenylethanimidamide is sourced from PubChem (CID 91236908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).