C35H34N4O4 — CID 91237886
2-[2-[4-(benzotriazol-2-yl)-6-tert-butyl-3-hydroxy-2-(2-phenylpropan-2-yl)phenoxy]ethyl]isoindole-1,3-dione (PubChem CID 91237886) has the molecular formula C35H34N4O4 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[2-[4-(benzotriazol-2-yl)-6-tert-butyl-3-hydroxy-2-(2-phenylpropan-2-yl)phenoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(benzotriazol-2-yl)-6-tert-butyl-3-hydroxy-2-(2-phenylpropan-2-yl)phenoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91237886 |
| Molecular Formula | C35H34N4O4 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[2-[4-(benzotriazol-2-yl)-6-tert-butyl-3-hydroxy-2-(2-phenylpropan-2-yl)phenoxy]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)c2ccccc2)c1OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H34N4O4/c1-34(2,3)25-21-28(39-36-26-17-11-12-18-27(26)37-39)30(40)29(35(4,5)22-13-7-6-8-14-22)31(25)43-20-19-38-32(41)23-15-9-10-16-24(23)33(38)42/h6-18,21,40H,19-20H2,1-5H3 |
| InChIKey | UUVYHKIJUZQXEU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|