C10H13N — CID 91238174
6,7,8,9-tetrahydro-3H-1-benzazepine (PubChem CID 91238174) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-3H-1-benzazepine.
| Compound Name | 6,7,8,9-tetrahydro-3H-1-benzazepine |
|---|---|
| PubChem CID | 91238174 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-3H-1-benzazepine |
| SMILES | C1=CC2=C(CCCC2)N=CC1 |
| InChI | InChI=1S/C10H13N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | KMDPTWUPUHCDEH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |