C16H21NO3S — CID 91239143
[(1S)-5-(dimethylcarbamoylsulfanyl)-2,3-dihydro-1H-inden-1-yl] butanoate (PubChem CID 91239143) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is [(1S)-5-(dimethylcarbamoylsulfanyl)-2,3-dihydro-1H-inden-1-yl] butanoate.
| Compound Name | [(1S)-5-(dimethylcarbamoylsulfanyl)-2,3-dihydro-1H-inden-1-yl] butanoate |
|---|---|
| PubChem CID | 91239143 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [(1S)-5-(dimethylcarbamoylsulfanyl)-2,3-dihydro-1H-inden-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CCc2cc(SC(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C16H21NO3S/c1-4-5-15(18)20-14-9-6-11-10-12(7-8-13(11)14)21-16(19)17(2)3/h7-8,10,14H,4-6,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | RXVOMYFNFLPZJZ-AWEZNQCLSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|