C19H20ClNO5 — CID 91242028
2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-(hydroxyamino)-6-(hydroxymethyl)oxan-4-one (PubChem CID 91242028) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-(hydroxyamino)-6-(hydroxymethyl)oxan-4-one.
| Compound Name | 2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-(hydroxyamino)-6-(hydroxymethyl)oxan-4-one |
|---|---|
| PubChem CID | 91242028 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-(hydroxyamino)-6-(hydroxymethyl)oxan-4-one |
| SMILES | O=C1CC(CO)OC(c2ccc(Cl)c(Cc3ccc(O)cc3)c2)C1NO |
| InChI | InChI=1S/C19H20ClNO5/c20-16-6-3-12(8-13(16)7-11-1-4-14(23)5-2-11)19-18(21-25)17(24)9-15(10-22)26-19/h1-6,8,15,18-19,21-23,25H,7,9-10H2 |
| InChIKey | YOFSBCUVDIIYAN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|