C21H17ClN2O — CID 91242276
2-(6-chloro-1-methylindol-3-yl)-N-naphthalen-2-ylacetamide (PubChem CID 91242276) has the molecular formula C21H17ClN2O and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-(6-chloro-1-methylindol-3-yl)-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(6-chloro-1-methylindol-3-yl)-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 91242276 |
| Molecular Formula | C21H17ClN2O |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-(6-chloro-1-methylindol-3-yl)-N-naphthalen-2-ylacetamide |
| SMILES | Cn1cc(CC(=O)Nc2ccc3ccccc3c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H17ClN2O/c1-24-13-16(19-9-7-17(22)12-20(19)24)11-21(25)23-18-8-6-14-4-2-3-5-15(14)10-18/h2-10,12-13H,11H2,1H3,(H,23,25) |
| InChIKey | IXDLBDWGTPNPOE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |