C13H13N3O2S — CID 91242964
4-(3-hydroxyphenyl)-2-sulfanylidene-3,4,4a,6,7,8-hexahydropyrido[4,3-d]pyrimidin-5-one (PubChem CID 91242964) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-2-sulfanylidene-3,4,4a,6,7,8-hexahydropyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 4-(3-hydroxyphenyl)-2-sulfanylidene-3,4,4a,6,7,8-hexahydropyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 91242964 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-(3-hydroxyphenyl)-2-sulfanylidene-3,4,4a,6,7,8-hexahydropyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=C1NCCC2=NC(=S)NC(c3cccc(O)c3)C12 |
| InChI | InChI=1S/C13H13N3O2S/c17-8-3-1-2-7(6-8)11-10-9(15-13(19)16-11)4-5-14-12(10)18/h1-3,6,10-11,17H,4-5H2,(H,14,18)(H,16,19) |
| InChIKey | FBFIZGQVPUUZHI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|