C18H14N2O3S — CID 123536629
4-(4-hydroxy-3-methoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one (PubChem CID 123536629) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-(4-hydroxy-3-methoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 4-(4-hydroxy-3-methoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 123536629 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-(4-hydroxy-3-methoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
| SMILES | COc1cc(C2NC(=S)N=C3c4ccccc4C(=O)C32)ccc1O |
| InChI | InChI=1S/C18H14N2O3S/c1-23-13-8-9(6-7-12(13)21)15-14-16(20-18(24)19-15)10-4-2-3-5-11(10)17(14)22/h2-8,14-15,21H,1H3,(H,19,24) |
| InChIKey | XBFPNFJKAWCJDE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|