About ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate
ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate (PubChem CID 91243178) has the molecular formula C21H33N3O4
and a molecular weight of 391.51 g/mol. Its IUPAC name is ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate.
Molecular Properties
| Compound Name | ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate |
| PubChem CID | 91243178 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate |
| SMILES | C=O.CC.CC.CNc1ccc(Nc2ccc(NOCOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O3.2C2H6.CH2O/c1-12(20)21-11-22-19-16-9-7-15(8-10-16)18-14-5-3-13(17-2)4-6-14;3*1-2/h3-10,17-19H,11H2,1-2H3;2*1-2H3;1H2 |
| InChIKey | NLONGLBPLVPAPV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate?
The IUPAC name of ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate (CID 91243178) is ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate.
What is the SMILES notation for ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate?
The canonical SMILES for ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate is C=O.CC.CC.CNc1ccc(Nc2ccc(NOCOC(C)=O)cc2)cc1.
What is the InChIKey of ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate?
The InChIKey is NLONGLBPLVPAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3.2C2H6.CH2O/c1-12(20)21-11-22-19-16-9-7-15(8-10-16)18-14-5-3-13(17-2)4-6-14;3*1-2/h3-10,17-19H,11H2,1-2H3;2*1-2H3;1H2.
What are the key properties of ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate?
ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate has a molecular weight of 391.51 g/mol, XLogP of 5.20, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formaldehyde;[4-[4-(methylamino)anilino]anilino]oxymethyl acetate is sourced from PubChem (CID 91243178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).