C27H32FN5O6S — CID 91243912
(5R)-5-[[3-[5-(2,3-dihydroxypropyl)-3-fluoro-6-methoxy-8H-1,5-naphthyridin-4-yl]propylamino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 91243912) has the molecular formula C27H32FN5O6S and a molecular weight of 573.65 g/mol. Its IUPAC name is (5R)-5-[[3-[5-(2,3-dihydroxypropyl)-3-fluoro-6-methoxy-8H-1,5-naphthyridin-4-yl]propylamino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[[3-[5-(2,3-dihydroxypropyl)-3-fluoro-6-methoxy-8H-1,5-naphthyridin-4-yl]propylamino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91243912 |
| Molecular Formula | C27H32FN5O6S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (5R)-5-[[3-[5-(2,3-dihydroxypropyl)-3-fluoro-6-methoxy-8H-1,5-naphthyridin-4-yl]propylamino]methyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | COC1=CCc2ncc(F)c(CCCNC[C@@H]3CN(c4ccc5c(c4)NC(=O)CS5)C(=O)O3)c2N1CC(O)CO |
| InChI | InChI=1S/C27H32FN5O6S/c1-38-25-7-5-21-26(33(25)12-17(35)14-34)19(20(28)11-30-21)3-2-8-29-10-18-13-32(27(37)39-18)16-4-6-23-22(9-16)31-24(36)15-40-23/h4,6-7,9,11,17-18,29,34-35H,2-3,5,8,10,12-15H2,1H3,(H,31,36)/t17?,18-/m1/s1 |
| InChIKey | JNWDHMDCPWCZNP-QRWMCTBCSA-N |
| XLogP | 2.02 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|