C30H35F3N4O8 — CID 91245848
(4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[4-(trifluoromethyl)piperidine-1-carbonyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91245848) has the molecular formula C30H35F3N4O8 and a molecular weight of 636.62 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[4-(trifluoromethyl)piperidine-1-carbonyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[4-(trifluoromethyl)piperidine-1-carbonyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91245848 |
| Molecular Formula | C30H35F3N4O8 |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[4-(trifluoromethyl)piperidine-1-carbonyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C(=O)N2CCC(C(F)(F)F)CC2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H35F3N4O8/c1-35(2)17-11-15(28(44)37-7-5-13(6-8-37)30(31,32)33)22(38)19-14(17)9-12-10-16-21(36(3)4)24(40)20(27(34)43)26(42)29(16,45)25(41)18(12)23(19)39/h11-13,16,18,20-21,38,45H,5-10H2,1-4H3,(H2,34,43)/t12-,16-,18?,20?,21-,29-/m0/s1 |
| InChIKey | XRWFUKGDYAEBRP-USNOAEIESA-N |
| XLogP | 0.35 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|