C10H17N — CID 91246664
(4Z)-6,7-dimethylocta-4,6-dien-2-imine (PubChem CID 91246664) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (4Z)-6,7-dimethylocta-4,6-dien-2-imine.
| Compound Name | (4Z)-6,7-dimethylocta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 91246664 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (4Z)-6,7-dimethylocta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C/C=C\C(C)=C(C)C |
| InChI | InChI=1S/C10H17N/c1-8(2)9(3)6-5-7-10(4)11/h5-6,11H,7H2,1-4H3/b6-5-,11-10+ |
| InChIKey | PCNKVWMADHSEDL-GWZUCBFCSA-N |
| XLogP | 3.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|