C22H24N4O2 — CID 91250525
5-acetyl-3-[N-(4-methylpiperazin-1-yl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91250525) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-acetyl-3-[N-(4-methylpiperazin-1-yl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-acetyl-3-[N-(4-methylpiperazin-1-yl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91250525 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-acetyl-3-[N-(4-methylpiperazin-1-yl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CC(=O)c1ccc2c(c1)C(C(=NN1CCN(C)CC1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C22H24N4O2/c1-15(27)17-8-9-19-18(14-17)20(22(28)23-19)21(16-6-4-3-5-7-16)24-26-12-10-25(2)11-13-26/h3-9,14,20H,10-13H2,1-2H3,(H,23,28) |
| InChIKey | VVBBPFQGWATOFZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|