C18H15F3N4 — CID 91258180
6-methyl-N-(2-pyridin-3-ylethyl)-2-(2,3,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 91258180) has the molecular formula C18H15F3N4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 6-methyl-N-(2-pyridin-3-ylethyl)-2-(2,3,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(2-pyridin-3-ylethyl)-2-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91258180 |
| Molecular Formula | C18H15F3N4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 6-methyl-N-(2-pyridin-3-ylethyl)-2-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCCc2cccnc2)nc(-c2cc(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C18H15F3N4/c1-11-7-16(23-6-4-12-3-2-5-22-10-12)25-18(24-11)14-8-13(19)9-15(20)17(14)21/h2-3,5,7-10H,4,6H2,1H3,(H,23,24,25) |
| InChIKey | UZBCCRWLBPEHLQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|