About N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide
N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide (PubChem CID 91264124) has the molecular formula C21H21ClN4O3
and a molecular weight of 412.88 g/mol. Its IUPAC name is N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide.
Molecular Properties
| Compound Name | N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide |
| PubChem CID | 91264124 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide |
| SMILES | Nc1nccc2cc(NC(=O)CCC(=O)N(CCO)c3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C21H21ClN4O3/c22-15-1-4-17(5-2-15)26(11-12-27)20(29)8-7-19(28)25-16-3-6-18-14(13-16)9-10-24-21(18)23/h1-6,9-10,13,27H,7-8,11-12H2,(H2,23,24)(H,25,28) |
| InChIKey | VHULDQHJXOQJSY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide?
The IUPAC name of N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide (CID 91264124) is N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide.
What is the SMILES notation for N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide?
The canonical SMILES for N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide is Nc1nccc2cc(NC(=O)CCC(=O)N(CCO)c3ccc(Cl)cc3)ccc12.
What is the InChIKey of N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide?
The InChIKey is VHULDQHJXOQJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN4O3/c22-15-1-4-17(5-2-15)26(11-12-27)20(29)8-7-19(28)25-16-3-6-18-14(13-16)9-10-24-21(18)23/h1-6,9-10,13,27H,7-8,11-12H2,(H2,23,24)(H,25,28).
What are the key properties of N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide?
N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide has a molecular weight of 412.88 g/mol, XLogP of 3.21, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminoisoquinolin-6-yl)-N'-(4-chlorophenyl)-N'-(2-hydroxyethyl)butanediamide is sourced from PubChem (CID 91264124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).