C17H20F15NO3 — CID 91264883
N-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide (PubChem CID 91264883) has the molecular formula C17H20F15NO3 and a molecular weight of 571.32 g/mol. Its IUPAC name is N-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide.
| Compound Name | N-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide |
|---|---|
| PubChem CID | 91264883 |
| Molecular Formula | C17H20F15NO3 |
| Molecular Weight | 571.32 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide |
| SMILES | CCN(CCCCC(CO)CO)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H20F15NO3/c1-2-33(6-4-3-5-9(7-34)8-35)10(36)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h9,34-35H,2-8H2,1H3 |
| InChIKey | SVGOIWGMXGTZSM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|