C13H24 — CID 91265902
1-(2,3-dimethylhex-1-enyl)-1,2-dimethylcyclopropane (PubChem CID 91265902) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1-(2,3-dimethylhex-1-enyl)-1,2-dimethylcyclopropane.
| Compound Name | 1-(2,3-dimethylhex-1-enyl)-1,2-dimethylcyclopropane |
|---|---|
| PubChem CID | 91265902 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1-(2,3-dimethylhex-1-enyl)-1,2-dimethylcyclopropane |
| SMILES | CCCC(C)C(C)=CC1(C)CC1C |
| InChI | InChI=1S/C13H24/c1-6-7-10(2)11(3)8-13(5)9-12(13)4/h8,10,12H,6-7,9H2,1-5H3 |
| InChIKey | UGBSBKPHDKVIFB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|