About 4-(1,2-dimethylcyclopropyl)heptanal
4-(1,2-dimethylcyclopropyl)heptanal (PubChem CID 123435086) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-(1,2-dimethylcyclopropyl)heptanal.
Molecular Properties
| Compound Name | 4-(1,2-dimethylcyclopropyl)heptanal |
| PubChem CID | 123435086 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 4-(1,2-dimethylcyclopropyl)heptanal |
| SMILES | CCCC(CCC=O)C1(C)CC1C |
| InChI | InChI=1S/C12H22O/c1-4-6-11(7-5-8-13)12(3)9-10(12)2/h8,10-11H,4-7,9H2,1-3H3 |
| InChIKey | RRAXGQQGRGUILR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-dimethylcyclopropyl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dimethylcyclopropyl)heptanal?
The IUPAC name of 4-(1,2-dimethylcyclopropyl)heptanal (CID 123435086) is 4-(1,2-dimethylcyclopropyl)heptanal.
What is the SMILES notation for 4-(1,2-dimethylcyclopropyl)heptanal?
The canonical SMILES for 4-(1,2-dimethylcyclopropyl)heptanal is CCCC(CCC=O)C1(C)CC1C.
What is the InChIKey of 4-(1,2-dimethylcyclopropyl)heptanal?
The InChIKey is RRAXGQQGRGUILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-4-6-11(7-5-8-13)12(3)9-10(12)2/h8,10-11H,4-7,9H2,1-3H3.
What are the key properties of 4-(1,2-dimethylcyclopropyl)heptanal?
4-(1,2-dimethylcyclopropyl)heptanal has a molecular weight of 182.31 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dimethylcyclopropyl)heptanal is sourced from PubChem (CID 123435086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).