C14H17F2N6O4P — CID 91266760
[1-[(aminomethylideneamino)methylideneamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-yl] methyl hydrogen phosphate (PubChem CID 91266760) has the molecular formula C14H17F2N6O4P and a molecular weight of 402.30 g/mol. Its IUPAC name is [1-[(aminomethylideneamino)methylideneamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-yl] methyl hydrogen phosphate.
| Compound Name | [1-[(aminomethylideneamino)methylideneamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 91266760 |
| Molecular Formula | C14H17F2N6O4P |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [1-[(aminomethylideneamino)methylideneamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC(C/N=C/N=C/N)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H17F2N6O4P/c1-25-27(23,24)26-14(5-18-8-19-7-17,6-22-10-20-9-21-22)12-3-2-11(15)4-13(12)16/h2-4,7-10H,5-6H2,1H3,(H,23,24)(H2,17,18,19) |
| InChIKey | PFRZINJTZMTYTQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|