C18H29N4O10P — CID 91267415
(2S,3R,4S,5R)-N-[4-(diethoxyphosphorylmethylamino)-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 91267415) has the molecular formula C18H29N4O10P and a molecular weight of 492.42 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N-[4-(diethoxyphosphorylmethylamino)-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,4S,5R)-N-[4-(diethoxyphosphorylmethylamino)-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 91267415 |
| Molecular Formula | C18H29N4O10P |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S,3R,4S,5R)-N-[4-(diethoxyphosphorylmethylamino)-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCOP(=O)(CNC(=O)CCCNC(=O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@H]1O)OCC |
| InChI | InChI=1S/C18H29N4O10P/c1-3-30-33(29,31-4-2)10-20-11(23)6-5-8-19-16(27)15-13(25)14(26)17(32-15)22-9-7-12(24)21-18(22)28/h7,9,13-15,17,25-26H,3-6,8,10H2,1-2H3,(H,19,27)(H,20,23)(H,21,24,28)/t13-,14+,15+,17-/m1/s1 |
| InChIKey | ZSWHPAZLBPPJLA-WBTNSWJXSA-N |
| XLogP | -1.61 |
| TPSA | 198.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|