C20H34N4O13P2 — CID 87466681
(2S,3R,4S,5R)-N-[2-[bis(diethoxyphosphoryl)methylamino]-2-oxoethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 87466681) has the molecular formula C20H34N4O13P2 and a molecular weight of 600.45 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N-[2-[bis(diethoxyphosphoryl)methylamino]-2-oxoethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,4S,5R)-N-[2-[bis(diethoxyphosphoryl)methylamino]-2-oxoethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 87466681 |
| Molecular Formula | C20H34N4O13P2 |
| Molecular Weight | 600.45 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (2S,3R,4S,5R)-N-[2-[bis(diethoxyphosphoryl)methylamino]-2-oxoethyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)CNC(=O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@H]1O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H34N4O13P2/c1-5-33-38(31,34-6-2)20(39(32,35-7-3)36-8-4)23-13(26)11-21-17(29)16-14(27)15(28)18(37-16)24-10-9-12(25)22-19(24)30/h9-10,14-16,18,20,27-28H,5-8,11H2,1-4H3,(H,21,29)(H,23,26)(H,22,25,30)/t14-,15+,16+,18-/m1/s1 |
| InChIKey | WMWRMXAIMHDCCY-MUQADHOPSA-N |
| XLogP | -0.80 |
| TPSA | 233.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.45 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|