C24H33N4O10P — CID 90939021
(2S,3R,4S,5R)-N-[4-[4-(diethoxyphosphorylmethyl)anilino]-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 90939021) has the molecular formula C24H33N4O10P and a molecular weight of 568.52 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N-[4-[4-(diethoxyphosphorylmethyl)anilino]-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,4S,5R)-N-[4-[4-(diethoxyphosphorylmethyl)anilino]-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 90939021 |
| Molecular Formula | C24H33N4O10P |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (2S,3R,4S,5R)-N-[4-[4-(diethoxyphosphorylmethyl)anilino]-4-oxobutyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCCNC(=O)[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@@H](O)[C@H]2O)cc1)OCC |
| InChI | InChI=1S/C24H33N4O10P/c1-3-36-39(35,37-4-2)14-15-7-9-16(10-8-15)26-17(29)6-5-12-25-22(33)21-19(31)20(32)23(38-21)28-13-11-18(30)27-24(28)34/h7-11,13,19-21,23,31-32H,3-6,12,14H2,1-2H3,(H,25,33)(H,26,29)(H,27,30,34)/t19-,20+,21+,23-/m1/s1 |
| InChIKey | OISCPADSGWNNAX-BESBDSHLSA-N |
| XLogP | 0.46 |
| TPSA | 198.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|