C24H33N4O11P — CID 91580310
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]propanamide (PubChem CID 91580310) has the molecular formula C24H33N4O11P and a molecular weight of 584.52 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]propanamide |
|---|---|
| PubChem CID | 91580310 |
| Molecular Formula | C24H33N4O11P |
| Molecular Weight | 584.52 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCNC(=O)C(O)[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)cc1)OCC |
| InChI | InChI=1S/C24H33N4O11P/c1-3-37-40(36,38-4-2)13-14-5-7-15(8-6-14)26-16(29)9-11-25-22(34)20(33)21-18(31)19(32)23(39-21)28-12-10-17(30)27-24(28)35/h5-8,10,12,18-21,23,31-33H,3-4,9,11,13H2,1-2H3,(H,25,34)(H,26,29)(H,27,30,35)/t18-,19+,20?,21-,23+/m0/s1 |
| InChIKey | WBYVXAUWNLIIGT-MOBLKYNXSA-N |
| XLogP | -0.57 |
| TPSA | 218.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.52 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|