C17H25N4O13P — CID 90921440
methyl N-[2-dimethoxyphosphoryl-2-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]acetyl]-N-methylcarbamate (PubChem CID 90921440) has the molecular formula C17H25N4O13P and a molecular weight of 524.38 g/mol. Its IUPAC name is methyl N-[2-dimethoxyphosphoryl-2-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]acetyl]-N-methylcarbamate.
| Compound Name | methyl N-[2-dimethoxyphosphoryl-2-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]acetyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90921440 |
| Molecular Formula | C17H25N4O13P |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | methyl N-[2-dimethoxyphosphoryl-2-[[2-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetyl]amino]acetyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C(=O)C(NC(=O)C(O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)P(=O)(OC)OC |
| InChI | InChI=1S/C17H25N4O13P/c1-20(17(29)31-2)14(27)13(35(30,32-3)33-4)19-12(26)10(25)11-8(23)9(24)15(34-11)21-6-5-7(22)18-16(21)28/h5-6,8-11,13,15,23-25H,1-4H3,(H,19,26)(H,18,22,28)/t8-,9+,10?,11-,13?,15+/m0/s1 |
| InChIKey | AMEXSQRUBPREOV-OIBYCYOMSA-N |
| XLogP | -3.33 |
| TPSA | 236.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|