C17H27N3O18P2 — CID 87405585
[(3R,4R,5R,6R)-3-acetamido-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-1,5,6,7-tetrahydroxy-2-oxoheptan-4-yl] phosphono hydrogen phosphate (PubChem CID 87405585) has the molecular formula C17H27N3O18P2 and a molecular weight of 623.35 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-3-acetamido-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-1,5,6,7-tetrahydroxy-2-oxoheptan-4-yl] phosphono hydrogen phosphate.
| Compound Name | [(3R,4R,5R,6R)-3-acetamido-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-1,5,6,7-tetrahydroxy-2-oxoheptan-4-yl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87405585 |
| Molecular Formula | C17H27N3O18P2 |
| Molecular Weight | 623.35 g/mol |
| Exact Mass | 623.08 |
| IUPAC Name | [(3R,4R,5R,6R)-3-acetamido-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-1,5,6,7-tetrahydroxy-2-oxoheptan-4-yl] phosphono hydrogen phosphate |
| SMILES | CC(=O)N[C@@H](C(=O)C(O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)[C@@H](OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H27N3O18P2/c1-5(22)18-8(14(9(25)6(23)4-21)37-40(34,35)38-39(31,32)33)10(26)11(27)15-12(28)13(29)16(36-15)20-3-2-7(24)19-17(20)30/h2-3,6,8-9,11-16,21,23,25,27-29H,4H2,1H3,(H,18,22)(H,34,35)(H,19,24,30)(H2,31,32,33)/t6-,8+,9-,11?,12+,13-,14-,15-,16-/m1/s1 |
| InChIKey | FTVJAXQLDSZQQX-AHFUZQBPSA-N |
| XLogP | -6.10 |
| TPSA | 344.93 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.35 |
| LogP ≤ 5 | -6.10 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|