About 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine
3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine (PubChem CID 91268177) has the molecular formula C22H19BrN2
and a molecular weight of 391.31 g/mol. Its IUPAC name is 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine.
Molecular Properties
| Compound Name | 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine |
| PubChem CID | 91268177 |
| Molecular Formula | C22H19BrN2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine |
| SMILES | BrC1=CCCC(C2=CC(c3cccnc3)=CC(c3cccnc3)C2)=C1 |
| InChI | InChI=1S/C22H19BrN2/c23-22-7-1-4-16(13-22)19-10-20(17-5-2-8-24-14-17)12-21(11-19)18-6-3-9-25-15-18/h2-3,5-10,12-15,21H,1,4,11H2 |
| InChIKey | AOYXZZXHXZKUAK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine?
The IUPAC name of 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine (CID 91268177) is 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine.
What is the SMILES notation for 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine?
The canonical SMILES for 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine is BrC1=CCCC(C2=CC(c3cccnc3)=CC(c3cccnc3)C2)=C1.
What is the InChIKey of 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine?
The InChIKey is AOYXZZXHXZKUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BrN2/c23-22-7-1-4-16(13-22)19-10-20(17-5-2-8-24-14-17)12-21(11-19)18-6-3-9-25-15-18/h2-3,5-10,12-15,21H,1,4,11H2.
What are the key properties of 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine?
3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine has a molecular weight of 391.31 g/mol, XLogP of 5.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-pyridin-3-ylcyclohexa-1,5-dien-1-yl]pyridine is sourced from PubChem (CID 91268177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).