C31H27N3 — CID 143898102
3,5-bis[(5R)-5-methyl-3-pyridin-3-ylcyclohepta-1,3,6-trien-1-yl]pyridine (PubChem CID 143898102) has the molecular formula C31H27N3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3,5-bis[(5R)-5-methyl-3-pyridin-3-ylcyclohepta-1,3,6-trien-1-yl]pyridine.
| Compound Name | 3,5-bis[(5R)-5-methyl-3-pyridin-3-ylcyclohepta-1,3,6-trien-1-yl]pyridine |
|---|---|
| PubChem CID | 143898102 |
| Molecular Formula | C31H27N3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3,5-bis[(5R)-5-methyl-3-pyridin-3-ylcyclohepta-1,3,6-trien-1-yl]pyridine |
| SMILES | C[C@@H]1C=CC(c2cncc(C3=CC(c4cccnc4)=C[C@H](C)C=C3)c2)=CC(c2cccnc2)=C1 |
| InChI | InChI=1S/C31H27N3/c1-22-7-9-24(15-28(13-22)26-5-3-11-32-18-26)30-17-31(21-34-20-30)25-10-8-23(2)14-29(16-25)27-6-4-12-33-19-27/h3-23H,1-2H3/t22-,23-/m1/s1 |
| InChIKey | JRTXFWFDEZTVOL-DHIUTWEWSA-N |
| XLogP | 7.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |