C17H19F2NO4 — CID 91268959
methyl 3-[(3R,4S)-3,4-difluorocyclopentyl]-2-phenylmethoxycarbonyliminopropanoate (PubChem CID 91268959) has the molecular formula C17H19F2NO4 and a molecular weight of 339.34 g/mol. Its IUPAC name is methyl 3-[(3R,4S)-3,4-difluorocyclopentyl]-2-phenylmethoxycarbonyliminopropanoate.
| Compound Name | methyl 3-[(3R,4S)-3,4-difluorocyclopentyl]-2-phenylmethoxycarbonyliminopropanoate |
|---|---|
| PubChem CID | 91268959 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 3-[(3R,4S)-3,4-difluorocyclopentyl]-2-phenylmethoxycarbonyliminopropanoate |
| SMILES | COC(=O)C(CC1C[C@@H](F)[C@@H](F)C1)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19F2NO4/c1-23-16(21)15(9-12-7-13(18)14(19)8-12)20-17(22)24-10-11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12?,13-,14+ |
| InChIKey | MKJUWBDTFVHJFX-AGUYFDCRSA-N |
| XLogP | 3.41 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|