C27H29ClN2O4S — CID 91270822
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91270822) has the molecular formula C27H29ClN2O4S and a molecular weight of 513.06 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91270822 |
| Molecular Formula | C27H29ClN2O4S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ccc(C)cc4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C27H29ClN2O4S/c1-16-7-9-20-21(13-16)30-26(29-20)35-24-22(31)15-27(34-25(24)32,18-5-3-4-6-18)12-11-17-8-10-23(33-2)19(28)14-17/h7-10,13-14,18,24H,3-6,11-12,15H2,1-2H3,(H,29,30) |
| InChIKey | UYBKDRHAVKPZMJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|