C35H42N2O — CID 91271764
ethane;(1S,2R,18R,26R)-2,5,21,27-tetramethyl-19-oxa-16,27-diazaoctacyclo[18.9.1.01,18.02,26.04,17.06,15.08,13.024,30]triaconta-4,6,8,10,12,14,16,20,22,24(30)-decaene (PubChem CID 91271764) has the molecular formula C35H42N2O and a molecular weight of 506.73 g/mol. Its IUPAC name is ethane;(1S,2R,18R,26R)-2,5,21,27-tetramethyl-19-oxa-16,27-diazaoctacyclo[18.9.1.01,18.02,26.04,17.06,15.08,13.024,30]triaconta-4,6,8,10,12,14,16,20,22,24(30)-decaene.
| Compound Name | ethane;(1S,2R,18R,26R)-2,5,21,27-tetramethyl-19-oxa-16,27-diazaoctacyclo[18.9.1.01,18.02,26.04,17.06,15.08,13.024,30]triaconta-4,6,8,10,12,14,16,20,22,24(30)-decaene |
|---|---|
| PubChem CID | 91271764 |
| Molecular Formula | C35H42N2O |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | ethane;(1S,2R,18R,26R)-2,5,21,27-tetramethyl-19-oxa-16,27-diazaoctacyclo[18.9.1.01,18.02,26.04,17.06,15.08,13.024,30]triaconta-4,6,8,10,12,14,16,20,22,24(30)-decaene |
| SMILES | CC.CC.Cc1ccc2c3c1O[C@H]1c4nc5cc6ccccc6cc5c(C)c4C[C@@]4(C)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C31H30N2O.2C2H6/c1-17-9-10-21-15-25-30(3)16-23-18(2)22-13-19-7-5-6-8-20(19)14-24(22)32-27(23)29-31(30,11-12-33(25)4)26(21)28(17)34-29;2*1-2/h5-10,13-14,25,29H,11-12,15-16H2,1-4H3;2*1-2H3/t25-,29+,30+,31+;;/m1../s1 |
| InChIKey | GHRAJVCNKNBDDR-JNACPTPNSA-N |
| XLogP | 8.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|