C37H44N2O — CID 91599091
ethane;(1S,2R,19R,27R)-2,5,22,28-tetramethyl-20-oxa-17,28-diazanonacyclo[19.9.1.18,11.01,19.02,27.04,18.06,16.025,31.015,32]dotriaconta-4(18),5,7,11(32),12,14,16,21,23,25(31)-decaene (PubChem CID 91599091) has the molecular formula C37H44N2O and a molecular weight of 532.77 g/mol. Its IUPAC name is ethane;(1S,2R,19R,27R)-2,5,22,28-tetramethyl-20-oxa-17,28-diazanonacyclo[19.9.1.18,11.01,19.02,27.04,18.06,16.025,31.015,32]dotriaconta-4(18),5,7,11(32),12,14,16,21,23,25(31)-decaene.
| Compound Name | ethane;(1S,2R,19R,27R)-2,5,22,28-tetramethyl-20-oxa-17,28-diazanonacyclo[19.9.1.18,11.01,19.02,27.04,18.06,16.025,31.015,32]dotriaconta-4(18),5,7,11(32),12,14,16,21,23,25(31)-decaene |
|---|---|
| PubChem CID | 91599091 |
| Molecular Formula | C37H44N2O |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | ethane;(1S,2R,19R,27R)-2,5,22,28-tetramethyl-20-oxa-17,28-diazanonacyclo[19.9.1.18,11.01,19.02,27.04,18.06,16.025,31.015,32]dotriaconta-4(18),5,7,11(32),12,14,16,21,23,25(31)-decaene |
| SMILES | CC.CC.Cc1ccc2c3c1O[C@H]1c4nc5c(cc6c7c(cccc75)CC6)c(C)c4C[C@@]4(C)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C33H32N2O.2C2H6/c1-17-8-9-21-15-25-32(3)16-24-18(2)23-14-20-11-10-19-6-5-7-22(26(19)20)28(23)34-29(24)31-33(32,12-13-35(25)4)27(21)30(17)36-31;2*1-2/h5-9,14,25,31H,10-13,15-16H2,1-4H3;2*1-2H3/t25-,31+,32+,33+;;/m1../s1 |
| InChIKey | IRTFGQRTNPHFJY-DERCGKDGSA-N |
| XLogP | 8.35 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|