4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid

C18H34O8 — CID 91273164

IUPAC4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid
SMILESO=C(O)C(O)CC(CCCCCCCCCC(O)CO)CC(O)C(=O)O
InChIInChI=1S/C18H34O8/c19-12-14(20)9-7-5-3-1-2-4-6-8-13(10-15(21)17(23)24)11-16(22)18(25)26/h13-16,19-22H,1-12H2,(H,23,24)(H,25,26)
InChIKeyXNURQVORMRNVHJ-UHFFFAOYSA-N
MW378.46 g/mol
LogP1.14
Rot. Bonds17

About 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid

4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid (PubChem CID 91273164) has the molecular formula C18H34O8 and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid.

Molecular Properties

Compound Name4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid
PubChem CID91273164
Molecular FormulaC18H34O8
Molecular Weight378.46 g/mol
Exact Mass378.23
IUPAC Name4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid
SMILESO=C(O)C(O)CC(CCCCCCCCCC(O)CO)CC(O)C(=O)O
InChIInChI=1S/C18H34O8/c19-12-14(20)9-7-5-3-1-2-4-6-8-13(10-15(21)17(23)24)11-16(22)18(25)26/h13-16,19-22H,1-12H2,(H,23,24)(H,25,26)
InChIKeyXNURQVORMRNVHJ-UHFFFAOYSA-N
XLogP1.14
TPSA155.52 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds17
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500378.46
LogP ≤ 51.14
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid?
The IUPAC name of 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid (CID 91273164) is 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid.
What is the SMILES notation for 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid?
The canonical SMILES for 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid is O=C(O)C(O)CC(CCCCCCCCCC(O)CO)CC(O)C(=O)O.
What is the InChIKey of 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid?
The InChIKey is XNURQVORMRNVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O8/c19-12-14(20)9-7-5-3-1-2-4-6-8-13(10-15(21)17(23)24)11-16(22)18(25)26/h13-16,19-22H,1-12H2,(H,23,24)(H,25,26).
What are the key properties of 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid?
4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid has a molecular weight of 378.46 g/mol, XLogP of 1.14, 17 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(10,11-dihydroxyundecyl)-2,6-dihydroxyheptanedioic acid is sourced from PubChem (CID 91273164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).