C14H19N3 — CID 91273459
N-(2,5-dihydropyridin-2-ylmethyl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 91273459) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-(2,5-dihydropyridin-2-ylmethyl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | N-(2,5-dihydropyridin-2-ylmethyl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 91273459 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-(2,5-dihydropyridin-2-ylmethyl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | CCN(Cc1ccccn1)CC1C=CCC=N1 |
| InChI | InChI=1S/C14H19N3/c1-2-17(11-13-7-3-5-9-15-13)12-14-8-4-6-10-16-14/h3-5,7-10,14H,2,6,11-12H2,1H3 |
| InChIKey | DFZNKUWADVWLRI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|