C32H51N3O7 — CID 91274663
[4-[[(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropyl)-1-benzofuran-5-yl]methyl]-8-methyl-2-propan-2-ylnonanoyl]amino]cyclohexyl] nitrate (PubChem CID 91274663) has the molecular formula C32H51N3O7 and a molecular weight of 589.77 g/mol. Its IUPAC name is [4-[[(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropyl)-1-benzofuran-5-yl]methyl]-8-methyl-2-propan-2-ylnonanoyl]amino]cyclohexyl] nitrate.
| Compound Name | [4-[[(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropyl)-1-benzofuran-5-yl]methyl]-8-methyl-2-propan-2-ylnonanoyl]amino]cyclohexyl] nitrate |
|---|---|
| PubChem CID | 91274663 |
| Molecular Formula | C32H51N3O7 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | [4-[[(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropyl)-1-benzofuran-5-yl]methyl]-8-methyl-2-propan-2-ylnonanoyl]amino]cyclohexyl] nitrate |
| SMILES | COCCCc1coc2ccc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NC3CCC(O[N+](=O)[O-])CC3)C(C)C)C(C)C)cc12 |
| InChI | InChI=1S/C32H51N3O7/c1-20(2)24(15-22-8-13-31-28(16-22)23(19-41-31)7-6-14-40-5)17-29(33)30(36)18-27(21(3)4)32(37)34-25-9-11-26(12-10-25)42-35(38)39/h8,13,16,19-21,24-27,29-30,36H,6-7,9-12,14-15,17-18,33H2,1-5H3,(H,34,37)/t24-,25?,26?,27-,29-,30-/m0/s1 |
| InChIKey | JQAUMPCIVSBZPC-IMSSMEOVSA-N |
| XLogP | 5.20 |
| TPSA | 150.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|