C26H46 — CID 91275461
11-(2,3-dimethylbutan-2-yl)-4,5,5,7,8,12-hexamethyltricyclo[10.1.1.02,4]tetradec-1(13)-ene (PubChem CID 91275461) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 11-(2,3-dimethylbutan-2-yl)-4,5,5,7,8,12-hexamethyltricyclo[10.1.1.02,4]tetradec-1(13)-ene.
| Compound Name | 11-(2,3-dimethylbutan-2-yl)-4,5,5,7,8,12-hexamethyltricyclo[10.1.1.02,4]tetradec-1(13)-ene |
|---|---|
| PubChem CID | 91275461 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 11-(2,3-dimethylbutan-2-yl)-4,5,5,7,8,12-hexamethyltricyclo[10.1.1.02,4]tetradec-1(13)-ene |
| SMILES | CC1CCC(C(C)(C)C(C)C)C2(C)C=C(C2)C2CC2(C)C(C)(C)CC1C |
| InChI | InChI=1S/C26H46/c1-17(2)24(7,8)22-12-11-18(3)19(4)13-23(5,6)26(10)16-21(26)20-14-25(22,9)15-20/h14,17-19,21-22H,11-13,15-16H2,1-10H3 |
| InChIKey | LOUKLKMCLIUNPF-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|