C23H28F3N4O+ — CID 91276324
8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-8-ium (PubChem CID 91276324) has the molecular formula C23H28F3N4O+ and a molecular weight of 433.50 g/mol. Its IUPAC name is 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-8-ium.
| Compound Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-8-ium |
|---|---|
| PubChem CID | 91276324 |
| Molecular Formula | C23H28F3N4O+ |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-8-ium |
| SMILES | COc1ccccc1N1CCN(CCCC[N+]23C=CC(C(F)(F)F)=CC2=CC=N3)CC1 |
| InChI | InChI=1S/C23H28F3N4O/c1-31-22-7-3-2-6-21(22)29-14-12-28(13-15-29)11-4-5-16-30-17-9-19(23(24,25)26)18-20(30)8-10-27-30/h2-3,6-10,17-18H,4-5,11-16H2,1H3/q+1 |
| InChIKey | SPVAIUVFWNMTQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|