C20H36O3Si — CID 91278114
(3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-[(2S)-5-methylhexa-3,5-dien-2-yl]oxan-2-one (PubChem CID 91278114) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-[(2S)-5-methylhexa-3,5-dien-2-yl]oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-[(2S)-5-methylhexa-3,5-dien-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 91278114 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-[(2S)-5-methylhexa-3,5-dien-2-yl]oxan-2-one |
| SMILES | C=C(C)C=C[C@H](C)[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C20H36O3Si/c1-13(2)11-12-14(3)17-15(4)18(16(5)19(21)22-17)23-24(9,10)20(6,7)8/h11-12,14-18H,1H2,2-10H3/t14-,15+,16+,17+,18-/m0/s1 |
| InChIKey | BAGFJZHRYFCNDW-TZNCUMHOSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|