C17H21ClN2O3S — CID 91278724
ethyl 1-[(2-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-4-(cyanomethyl)piperidine-4-carboxylate (PubChem CID 91278724) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is ethyl 1-[(2-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-4-(cyanomethyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-4-(cyanomethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91278724 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl 1-[(2-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-4-(cyanomethyl)piperidine-4-carboxylate |
| SMILES | C=S(=O)(c1ccccc1Cl)N1CCC(CC#N)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-3-23-16(21)17(8-11-19)9-12-20(13-10-17)24(2,22)15-7-5-4-6-14(15)18/h4-7H,2-3,8-10,12-13H2,1H3 |
| InChIKey | VYXHIECXMOQLEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|