C9H15N — CID 91279231
3,6,7-trimethyl-4,5-dihydro-3H-azepine (PubChem CID 91279231) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3,6,7-trimethyl-4,5-dihydro-3H-azepine.
| Compound Name | 3,6,7-trimethyl-4,5-dihydro-3H-azepine |
|---|---|
| PubChem CID | 91279231 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3,6,7-trimethyl-4,5-dihydro-3H-azepine |
| SMILES | CC1=C(C)N=CC(C)CC1 |
| InChI | InChI=1S/C9H15N/c1-7-4-5-8(2)9(3)10-6-7/h6-7H,4-5H2,1-3H3 |
| InChIKey | ULFIQDBIOQYTRB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |