C11H13N — CID 91279690
3,4,8,9-tetrahydrobenzo[7]annulen-5-imine (PubChem CID 91279690) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3,4,8,9-tetrahydrobenzo[7]annulen-5-imine.
| Compound Name | 3,4,8,9-tetrahydrobenzo[7]annulen-5-imine |
|---|---|
| PubChem CID | 91279690 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3,4,8,9-tetrahydrobenzo[7]annulen-5-imine |
| SMILES | [H]/N=C1\C=CCCC2=C1CCC=C2 |
| InChI | InChI=1S/C11H13N/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1,4-5,8,12H,2-3,6-7H2/b12-11+ |
| InChIKey | LBKKUNDPEXZRDT-VAWYXSNFSA-N |
| XLogP | 3.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|