C9H14O8 — CID 91279772
hydroperoxyethene;2-(3-hydroperoxyprop-2-enyl)butanedioic acid (PubChem CID 91279772) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is hydroperoxyethene;2-(3-hydroperoxyprop-2-enyl)butanedioic acid.
| Compound Name | hydroperoxyethene;2-(3-hydroperoxyprop-2-enyl)butanedioic acid |
|---|---|
| PubChem CID | 91279772 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | hydroperoxyethene;2-(3-hydroperoxyprop-2-enyl)butanedioic acid |
| SMILES | C=COO.O=C(O)CC(CC=COO)C(=O)O |
| InChI | InChI=1S/C7H10O6.C2H4O2/c8-6(9)4-5(7(10)11)2-1-3-13-12;1-2-4-3/h1,3,5,12H,2,4H2,(H,8,9)(H,10,11);2-3H,1H2 |
| InChIKey | RZGFLGWXAKWPGZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|