C21H31ClN2O3 — CID 91282254
tert-butyl 4-[2-(2-acetamidoethyl)-4-chloro-5-methylphenyl]piperidine-1-carboxylate (PubChem CID 91282254) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-acetamidoethyl)-4-chloro-5-methylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-acetamidoethyl)-4-chloro-5-methylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91282254 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl 4-[2-(2-acetamidoethyl)-4-chloro-5-methylphenyl]piperidine-1-carboxylate |
| SMILES | CC(=O)NCCc1cc(Cl)c(C)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31ClN2O3/c1-14-12-18(17(13-19(14)22)6-9-23-15(2)25)16-7-10-24(11-8-16)20(26)27-21(3,4)5/h12-13,16H,6-11H2,1-5H3,(H,23,25) |
| InChIKey | PYQBTQUJRRPBSD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |