C13H14N6OS — CID 9128230
N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9128230) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9128230 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | C[C@@](C#N)(NC(=O)Cn1nnc(-c2ccsc2)n1)C1CC1 |
| InChI | InChI=1S/C13H14N6OS/c1-13(8-14,10-2-3-10)15-11(20)6-19-17-12(16-18-19)9-4-5-21-7-9/h4-5,7,10H,2-3,6H2,1H3,(H,15,20)/t13-/m0/s1 |
| InChIKey | OOQLGONOFUPMIU-ZDUSSCGKSA-N |
| XLogP | 1.21 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |